C38H43N5O4S — CID 67733327
N-(benzenesulfonyl)-2-[4-[[2-butyl-5-[methylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]benzamide (PubChem CID 67733327) has the molecular formula C38H43N5O4S and a molecular weight of 665.86 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[4-[[2-butyl-5-[methylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]benzamide.
| Compound Name | N-(benzenesulfonyl)-2-[4-[[2-butyl-5-[methylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 67733327 |
| Molecular Formula | C38H43N5O4S |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 665.30 |
| IUPAC Name | N-(benzenesulfonyl)-2-[4-[[2-butyl-5-[methylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]benzamide |
| SMILES | CCCCCN(C(=O)NC)c1ccc2c(c1)nc(CCCC)n2Cc1ccc(-c2ccccc2C(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H43N5O4S/c1-4-6-13-25-42(38(45)39-3)30-23-24-35-34(26-30)40-36(18-7-5-2)43(35)27-28-19-21-29(22-20-28)32-16-11-12-17-33(32)37(44)41-48(46,47)31-14-9-8-10-15-31/h8-12,14-17,19-24,26H,4-7,13,18,25,27H2,1-3H3,(H,39,45)(H,41,44) |
| InChIKey | BZYXTMFLISMSQM-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|