C26H26ClFN6O3S — CID 156621456
N-[2-chloro-5-[3-[4-(2-methoxyethyl)piperazin-1-yl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide (PubChem CID 156621456) has the molecular formula C26H26ClFN6O3S and a molecular weight of 557.05 g/mol. Its IUPAC name is N-[2-chloro-5-[3-[4-(2-methoxyethyl)piperazin-1-yl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-chloro-5-[3-[4-(2-methoxyethyl)piperazin-1-yl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 156621456 |
| Molecular Formula | C26H26ClFN6O3S |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[2-chloro-5-[3-[4-(2-methoxyethyl)piperazin-1-yl]quinoxalin-6-yl]-3-pyridinyl]-4-fluorobenzenesulfonamide |
| SMILES | COCCN1CCN(c2cnc3ccc(-c4cnc(Cl)c(NS(=O)(=O)c5ccc(F)cc5)c4)cc3n2)CC1 |
| InChI | InChI=1S/C26H26ClFN6O3S/c1-37-13-12-33-8-10-34(11-9-33)25-17-29-22-7-2-18(14-23(22)31-25)19-15-24(26(27)30-16-19)32-38(35,36)21-5-3-20(28)4-6-21/h2-7,14-17,32H,8-13H2,1H3 |
| InChIKey | CSXPHCNRLYQFIH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|