C26H44Cl2N2Si2 — CID 156621979
[2,3-dichloro-8-tri(propan-2-yl)silylquinoxalin-5-yl]-tri(propan-2-yl)silane (PubChem CID 156621979) has the molecular formula C26H44Cl2N2Si2 and a molecular weight of 511.73 g/mol. Its IUPAC name is [2,3-dichloro-8-tri(propan-2-yl)silylquinoxalin-5-yl]-tri(propan-2-yl)silane.
| Compound Name | [2,3-dichloro-8-tri(propan-2-yl)silylquinoxalin-5-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 156621979 |
| Molecular Formula | C26H44Cl2N2Si2 |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [2,3-dichloro-8-tri(propan-2-yl)silylquinoxalin-5-yl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](c1ccc([Si](C(C)C)(C(C)C)C(C)C)c2nc(Cl)c(Cl)nc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H44Cl2N2Si2/c1-15(2)31(16(3)4,17(5)6)21-13-14-22(24-23(21)29-25(27)26(28)30-24)32(18(7)8,19(9)10)20(11)12/h13-20H,1-12H3 |
| InChIKey | OOGPTOWVIWZYCI-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|