C27H4F5N9O2 — CID 156623407
2-[4-(5,6-diisocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole-5,6-dicarbonitrile (PubChem CID 156623407) has the molecular formula C27H4F5N9O2 and a molecular weight of 581.38 g/mol. Its IUPAC name is 2-[4-(5,6-diisocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole-5,6-dicarbonitrile.
| Compound Name | 2-[4-(5,6-diisocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 156623407 |
| Molecular Formula | C27H4F5N9O2 |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 581.04 |
| IUPAC Name | 2-[4-(5,6-diisocyano-1,3-benzoxazol-2-yl)-6-(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-1,3-benzoxazole-5,6-dicarbonitrile |
| SMILES | [C-]#[N+]c1cc2nc(-c3nc(-c4nc5cc(C#N)c(C#N)cc5o4)nc(-c4c(F)c(F)c(F)c(F)c4F)n3)oc2cc1[N+]#[C-] |
| InChI | InChI=1S/C27H4F5N9O2/c1-35-11-5-14-16(6-12(11)36-2)43-27(38-14)25-40-23(17-18(28)20(30)22(32)21(31)19(17)29)39-24(41-25)26-37-13-3-9(7-33)10(8-34)4-15(13)42-26/h3-6H |
| InChIKey | CCFDJNPGHXUJLJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 147.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|