C18H18F2N2O2 — CID 156623675
2-[(1S)-1-cyclopropylethyl]-5-[3-(difluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 156623675) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-[(1S)-1-cyclopropylethyl]-5-[3-(difluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[(1S)-1-cyclopropylethyl]-5-[3-(difluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156623675 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-[(1S)-1-cyclopropylethyl]-5-[3-(difluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | C[C@H](c1ncc(-c2cccc(OC(F)F)c2)cc1C(N)=O)C1CC1 |
| InChI | InChI=1S/C18H18F2N2O2/c1-10(11-5-6-11)16-15(17(21)23)8-13(9-22-16)12-3-2-4-14(7-12)24-18(19)20/h2-4,7-11,18H,5-6H2,1H3,(H2,21,23)/t10-/m0/s1 |
| InChIKey | BNACDXNPAJLTHX-JTQLQIEISA-N |
| XLogP | 3.96 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |