C18H15F2N5O3 — CID 90415667
5-[[6-[3-(difluoromethoxy)phenyl]-5-methoxypyrazin-2-yl]methyl]pyrimidine-2-carboxamide (PubChem CID 90415667) has the molecular formula C18H15F2N5O3 and a molecular weight of 387.35 g/mol. Its IUPAC name is 5-[[6-[3-(difluoromethoxy)phenyl]-5-methoxypyrazin-2-yl]methyl]pyrimidine-2-carboxamide.
| Compound Name | 5-[[6-[3-(difluoromethoxy)phenyl]-5-methoxypyrazin-2-yl]methyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 90415667 |
| Molecular Formula | C18H15F2N5O3 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 5-[[6-[3-(difluoromethoxy)phenyl]-5-methoxypyrazin-2-yl]methyl]pyrimidine-2-carboxamide |
| SMILES | COc1ncc(Cc2cnc(C(N)=O)nc2)nc1-c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H15F2N5O3/c1-27-17-14(11-3-2-4-13(6-11)28-18(19)20)25-12(9-24-17)5-10-7-22-16(15(21)26)23-8-10/h2-4,6-9,18H,5H2,1H3,(H2,21,26) |
| InChIKey | LSBUIVVYLFRXIZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |