C18H14ClF2N3O2 — CID 86296758
5-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-2-methoxypyrimidine (PubChem CID 86296758) has the molecular formula C18H14ClF2N3O2 and a molecular weight of 377.78 g/mol. Its IUPAC name is 5-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-2-methoxypyrimidine.
| Compound Name | 5-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-2-methoxypyrimidine |
|---|---|
| PubChem CID | 86296758 |
| Molecular Formula | C18H14ClF2N3O2 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 5-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-2-methoxypyrimidine |
| SMILES | COc1ncc(Cc2cnc(OC(F)F)c(-c3cccc(Cl)c3)c2)cn1 |
| InChI | InChI=1S/C18H14ClF2N3O2/c1-25-18-23-9-12(10-24-18)5-11-6-15(13-3-2-4-14(19)7-13)16(22-8-11)26-17(20)21/h2-4,6-10,17H,5H2,1H3 |
| InChIKey | RXNORFHBZQAQJS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |