C20H17ClF2N2O — CID 140545391
5-[[3-(3-chlorophenyl)-4-(difluoromethoxy)phenyl]methyl]-N-methylpyridin-2-amine (PubChem CID 140545391) has the molecular formula C20H17ClF2N2O and a molecular weight of 374.82 g/mol. Its IUPAC name is 5-[[3-(3-chlorophenyl)-4-(difluoromethoxy)phenyl]methyl]-N-methylpyridin-2-amine.
| Compound Name | 5-[[3-(3-chlorophenyl)-4-(difluoromethoxy)phenyl]methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 140545391 |
| Molecular Formula | C20H17ClF2N2O |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-[[3-(3-chlorophenyl)-4-(difluoromethoxy)phenyl]methyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(Cc2ccc(OC(F)F)c(-c3cccc(Cl)c3)c2)cn1 |
| InChI | InChI=1S/C20H17ClF2N2O/c1-24-19-8-6-14(12-25-19)9-13-5-7-18(26-20(22)23)17(10-13)15-3-2-4-16(21)11-15/h2-8,10-12,20H,9H2,1H3,(H,24,25) |
| InChIKey | GTICZLAKNLVSKA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |