C21H21Cl2NO — CID 68789943
[4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]methanamine;hydrochloride (PubChem CID 68789943) has the molecular formula C21H21Cl2NO and a molecular weight of 374.31 g/mol. Its IUPAC name is [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]methanamine;hydrochloride.
| Compound Name | [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 68789943 |
| Molecular Formula | C21H21Cl2NO |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]phenyl]methanamine;hydrochloride |
| SMILES | COc1ccc(Cc2ccc(CN)cc2)cc1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C21H20ClNO.ClH/c1-24-21-10-9-17(11-15-5-7-16(14-23)8-6-15)12-20(21)18-3-2-4-19(22)13-18;/h2-10,12-13H,11,14,23H2,1H3;1H |
| InChIKey | MAFQMQKRPSFWGE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |