[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate

C15H13ClO4 — CID 141248604

IUPAC[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate
SMILESCOc1ccc(COC(=O)O)cc1-c1cccc(Cl)c1
InChIInChI=1S/C15H13ClO4/c1-19-14-6-5-10(9-20-15(17)18)7-13(14)11-3-2-4-12(16)8-11/h2-8H,9H2,1H3,(H,17,18)
InChIKeyKSMCAYMYDGIKAI-UHFFFAOYSA-N
MW292.72 g/mol
LogP4.21
Rot. Bonds4

About [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate

[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate (PubChem CID 141248604) has the molecular formula C15H13ClO4 and a molecular weight of 292.72 g/mol. Its IUPAC name is [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate.

Molecular Properties

Compound Name[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate
PubChem CID141248604
Molecular FormulaC15H13ClO4
Molecular Weight292.72 g/mol
Exact Mass292.05
IUPAC Name[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate
SMILESCOc1ccc(COC(=O)O)cc1-c1cccc(Cl)c1
InChIInChI=1S/C15H13ClO4/c1-19-14-6-5-10(9-20-15(17)18)7-13(14)11-3-2-4-12(16)8-11/h2-8H,9H2,1H3,(H,17,18)
InChIKeyKSMCAYMYDGIKAI-UHFFFAOYSA-N
XLogP4.21
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.72
LogP ≤ 54.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate?
The IUPAC name of [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate (CID 141248604) is [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate.
What is the SMILES notation for [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate?
The canonical SMILES for [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate is COc1ccc(COC(=O)O)cc1-c1cccc(Cl)c1.
What is the InChIKey of [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate?
The InChIKey is KSMCAYMYDGIKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO4/c1-19-14-6-5-10(9-20-15(17)18)7-13(14)11-3-2-4-12(16)8-11/h2-8H,9H2,1H3,(H,17,18).
What are the key properties of [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate?
[3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate has a molecular weight of 292.72 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-chlorophenyl)-4-methoxyphenyl]methyl hydrogen carbonate is sourced from PubChem (CID 141248604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).