C20H19Cl2NO — CID 68789956
4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]aniline;hydrochloride (PubChem CID 68789956) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is 4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]aniline;hydrochloride.
| Compound Name | 4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]aniline;hydrochloride |
|---|---|
| PubChem CID | 68789956 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 4-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]aniline;hydrochloride |
| SMILES | COc1ccc(Cc2ccc(N)cc2)cc1-c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C20H18ClNO.ClH/c1-23-20-10-7-15(11-14-5-8-18(22)9-6-14)12-19(20)16-3-2-4-17(21)13-16;/h2-10,12-13H,11,22H2,1H3;1H |
| InChIKey | SKAAXBIYQCUNOJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|