C23H23ClN2O2 — CID 58020299
4-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]morpholine (PubChem CID 58020299) has the molecular formula C23H23ClN2O2 and a molecular weight of 394.90 g/mol. Its IUPAC name is 4-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]morpholine.
| Compound Name | 4-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 58020299 |
| Molecular Formula | C23H23ClN2O2 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 4-[5-[[3-(3-chlorophenyl)-4-methoxyphenyl]methyl]-2-pyridinyl]morpholine |
| SMILES | COc1ccc(Cc2ccc(N3CCOCC3)nc2)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H23ClN2O2/c1-27-22-7-5-17(14-21(22)19-3-2-4-20(24)15-19)13-18-6-8-23(25-16-18)26-9-11-28-12-10-26/h2-8,14-16H,9-13H2,1H3 |
| InChIKey | LTOFTTVNOBKVPQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |