C26H19ClF2N2O — CID 150659230
6-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-9H-fluoren-3-amine (PubChem CID 150659230) has the molecular formula C26H19ClF2N2O and a molecular weight of 448.90 g/mol. Its IUPAC name is 6-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-9H-fluoren-3-amine.
| Compound Name | 6-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-9H-fluoren-3-amine |
|---|---|
| PubChem CID | 150659230 |
| Molecular Formula | C26H19ClF2N2O |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 6-[[5-(3-chlorophenyl)-6-(difluoromethoxy)-3-pyridinyl]methyl]-9H-fluoren-3-amine |
| SMILES | Nc1ccc2c(c1)-c1cc(Cc3cnc(OC(F)F)c(-c4cccc(Cl)c4)c3)ccc1C2 |
| InChI | InChI=1S/C26H19ClF2N2O/c27-20-3-1-2-17(12-20)24-10-16(14-31-25(24)32-26(28)29)8-15-4-5-18-11-19-6-7-21(30)13-23(19)22(18)9-15/h1-7,9-10,12-14,26H,8,11,30H2 |
| InChIKey | JDNDLPOYFLLSBP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|