C19H15ClF2N2O — CID 86304918
3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(6-methyl-3-pyridinyl)methyl]pyridine (PubChem CID 86304918) has the molecular formula C19H15ClF2N2O and a molecular weight of 360.79 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(6-methyl-3-pyridinyl)methyl]pyridine.
| Compound Name | 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(6-methyl-3-pyridinyl)methyl]pyridine |
|---|---|
| PubChem CID | 86304918 |
| Molecular Formula | C19H15ClF2N2O |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(6-methyl-3-pyridinyl)methyl]pyridine |
| SMILES | Cc1ccc(Cc2cnc(OC(F)F)c(-c3cccc(Cl)c3)c2)cn1 |
| InChI | InChI=1S/C19H15ClF2N2O/c1-12-5-6-13(10-23-12)7-14-8-17(15-3-2-4-16(20)9-15)18(24-11-14)25-19(21)22/h2-6,8-11,19H,7H2,1H3 |
| InChIKey | UVZFPKKCTFUSOS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |