C19H17ClF2N2O — CID 141416182
3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(1-methyl-2H-pyridin-5-yl)methyl]pyridine (PubChem CID 141416182) has the molecular formula C19H17ClF2N2O and a molecular weight of 362.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(1-methyl-2H-pyridin-5-yl)methyl]pyridine.
| Compound Name | 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(1-methyl-2H-pyridin-5-yl)methyl]pyridine |
|---|---|
| PubChem CID | 141416182 |
| Molecular Formula | C19H17ClF2N2O |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 3-(3-chlorophenyl)-2-(difluoromethoxy)-5-[(1-methyl-2H-pyridin-5-yl)methyl]pyridine |
| SMILES | CN1C=C(Cc2cnc(OC(F)F)c(-c3cccc(Cl)c3)c2)C=CC1 |
| InChI | InChI=1S/C19H17ClF2N2O/c1-24-7-3-4-13(12-24)8-14-9-17(15-5-2-6-16(20)10-15)18(23-11-14)25-19(21)22/h2-6,9-12,19H,7-8H2,1H3 |
| InChIKey | IBOLIQCWBHFFKF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |