C21H20ClFN2O2 — CID 70228503
2-[[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]amino]ethanol (PubChem CID 70228503) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is 2-[[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]amino]ethanol.
| Compound Name | 2-[[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]amino]ethanol |
|---|---|
| PubChem CID | 70228503 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-pyridinyl]amino]ethanol |
| SMILES | COc1ccc(Cc2ccc(NCCO)nc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H20ClFN2O2/c1-27-18-7-6-16(11-14-5-8-19(25-13-14)24-9-10-26)21(23)20(18)15-3-2-4-17(22)12-15/h2-8,12-13,26H,9-11H2,1H3,(H,24,25) |
| InChIKey | RUERYDSOPDGQNP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |