C24H24ClFN2O3 — CID 140592593
3-[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-1-oxidopyridin-1-ium-2-yl]-N-ethylpropanamide (PubChem CID 140592593) has the molecular formula C24H24ClFN2O3 and a molecular weight of 442.92 g/mol. Its IUPAC name is 3-[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-1-oxidopyridin-1-ium-2-yl]-N-ethylpropanamide.
| Compound Name | 3-[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-1-oxidopyridin-1-ium-2-yl]-N-ethylpropanamide |
|---|---|
| PubChem CID | 140592593 |
| Molecular Formula | C24H24ClFN2O3 |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-[5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-1-oxidopyridin-1-ium-2-yl]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCc1ccc(Cc2ccc(OC)c(-c3cccc(Cl)c3)c2F)c[n+]1[O-] |
| InChI | InChI=1S/C24H24ClFN2O3/c1-3-27-22(29)12-10-20-9-7-16(15-28(20)30)13-18-8-11-21(31-2)23(24(18)26)17-5-4-6-19(25)14-17/h4-9,11,14-15H,3,10,12-13H2,1-2H3,(H,27,29) |
| InChIKey | CBNWUMZEURADPS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|