C21H22ClFN2O — CID 143810459
5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyridin-2-amine;ethane (PubChem CID 143810459) has the molecular formula C21H22ClFN2O and a molecular weight of 372.87 g/mol. Its IUPAC name is 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyridin-2-amine;ethane.
| Compound Name | 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 143810459 |
| Molecular Formula | C21H22ClFN2O |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyridin-2-amine;ethane |
| SMILES | CC.COc1ccc(Cc2ccc(N)nc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H16ClFN2O.C2H6/c1-24-16-7-6-14(9-12-5-8-17(22)23-11-12)19(21)18(16)13-3-2-4-15(20)10-13;1-2/h2-8,10-11H,9H2,1H3,(H2,22,23);1-2H3 |
| InChIKey | HUKVFBJDAWSHAU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |