C18H15ClFN3O — CID 58020028
5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyrimidin-2-amine (PubChem CID 58020028) has the molecular formula C18H15ClFN3O and a molecular weight of 343.79 g/mol. Its IUPAC name is 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyrimidin-2-amine.
| Compound Name | 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58020028 |
| Molecular Formula | C18H15ClFN3O |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]pyrimidin-2-amine |
| SMILES | COc1ccc(Cc2cnc(N)nc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H15ClFN3O/c1-24-15-6-5-13(7-11-9-22-18(21)23-10-11)17(20)16(15)12-3-2-4-14(19)8-12/h2-6,8-10H,7H2,1H3,(H2,21,22,23) |
| InChIKey | VUSIIZVVJJHJOI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |