C40H32Cl2F2N2O6 — CID 159113776
3-amino-5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]phenol;3-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-5-nitrophenol (PubChem CID 159113776) has the molecular formula C40H32Cl2F2N2O6 and a molecular weight of 745.61 g/mol. Its IUPAC name is 3-amino-5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]phenol;3-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-5-nitrophenol.
| Compound Name | 3-amino-5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]phenol;3-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-5-nitrophenol |
|---|---|
| PubChem CID | 159113776 |
| Molecular Formula | C40H32Cl2F2N2O6 |
| Molecular Weight | 745.61 g/mol |
| Exact Mass | 744.16 |
| IUPAC Name | 3-amino-5-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]phenol;3-[[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methyl]-5-nitrophenol |
| SMILES | COc1ccc(Cc2cc(N)cc(O)c2)c(F)c1-c1cccc(Cl)c1.COc1ccc(Cc2cc(O)cc([N+](=O)[O-])c2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15ClFNO4.C20H17ClFNO2/c1-27-18-6-5-14(7-12-8-16(23(25)26)11-17(24)9-12)20(22)19(18)13-3-2-4-15(21)10-13;1-25-18-6-5-14(7-12-8-16(23)11-17(24)9-12)20(22)19(18)13-3-2-4-15(21)10-13/h2-6,8-11,24H,7H2,1H3;2-6,8-11,24H,7,23H2,1H3 |
| InChIKey | KEVBMSOAEKNAIQ-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.61 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|