C22H20ClFN2O3 — CID 68790612
[4-[2-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]-2-hydroxyethyl]phenyl]urea (PubChem CID 68790612) has the molecular formula C22H20ClFN2O3 and a molecular weight of 414.86 g/mol. Its IUPAC name is [4-[2-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]-2-hydroxyethyl]phenyl]urea.
| Compound Name | [4-[2-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]-2-hydroxyethyl]phenyl]urea |
|---|---|
| PubChem CID | 68790612 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [4-[2-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]-2-hydroxyethyl]phenyl]urea |
| SMILES | COc1ccc(C(O)Cc2ccc(NC(N)=O)cc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H20ClFN2O3/c1-29-19-10-9-17(21(24)20(19)14-3-2-4-15(23)12-14)18(27)11-13-5-7-16(8-6-13)26-22(25)28/h2-10,12,18,27H,11H2,1H3,(H3,25,26,28) |
| InChIKey | UEQRWYSIUGDZLT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |