C41H31Cl2F2N3O5 — CID 159705006
(4-aminophenyl)-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methanone;[4-[3-(3-chlorophenyl)-2-fluoro-4-methoxybenzoyl]phenyl]urea (PubChem CID 159705006) has the molecular formula C41H31Cl2F2N3O5 and a molecular weight of 754.62 g/mol. Its IUPAC name is (4-aminophenyl)-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methanone;[4-[3-(3-chlorophenyl)-2-fluoro-4-methoxybenzoyl]phenyl]urea.
| Compound Name | (4-aminophenyl)-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methanone;[4-[3-(3-chlorophenyl)-2-fluoro-4-methoxybenzoyl]phenyl]urea |
|---|---|
| PubChem CID | 159705006 |
| Molecular Formula | C41H31Cl2F2N3O5 |
| Molecular Weight | 754.62 g/mol |
| Exact Mass | 753.16 |
| IUPAC Name | (4-aminophenyl)-[3-(3-chlorophenyl)-2-fluoro-4-methoxyphenyl]methanone;[4-[3-(3-chlorophenyl)-2-fluoro-4-methoxybenzoyl]phenyl]urea |
| SMILES | COc1ccc(C(=O)c2ccc(N)cc2)c(F)c1-c1cccc(Cl)c1.COc1ccc(C(=O)c2ccc(NC(N)=O)cc2)c(F)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClFN2O3.C20H15ClFNO2/c1-28-17-10-9-16(19(23)18(17)13-3-2-4-14(22)11-13)20(26)12-5-7-15(8-6-12)25-21(24)27;1-25-17-10-9-16(20(24)12-5-7-15(23)8-6-12)19(22)18(17)13-3-2-4-14(21)11-13/h2-11H,1H3,(H3,24,25,27);2-11H,23H2,1H3 |
| InChIKey | MYCGKIAHYSCVKJ-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.62 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|