C24H22F2N2O3 — CID 70229104
[4-[[3-(3-acetylphenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-fluorophenyl]methylurea (PubChem CID 70229104) has the molecular formula C24H22F2N2O3 and a molecular weight of 424.45 g/mol. Its IUPAC name is [4-[[3-(3-acetylphenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-fluorophenyl]methylurea.
| Compound Name | [4-[[3-(3-acetylphenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-fluorophenyl]methylurea |
|---|---|
| PubChem CID | 70229104 |
| Molecular Formula | C24H22F2N2O3 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [4-[[3-(3-acetylphenyl)-2-fluoro-4-methoxyphenyl]methyl]-2-fluorophenyl]methylurea |
| SMILES | COc1ccc(Cc2ccc(CNC(N)=O)c(F)c2)c(F)c1-c1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C24H22F2N2O3/c1-14(29)16-4-3-5-17(12-16)22-21(31-2)9-8-18(23(22)26)10-15-6-7-19(20(25)11-15)13-28-24(27)30/h3-9,11-12H,10,13H2,1-2H3,(H3,27,28,30) |
| InChIKey | PLNFJAFOZDNYPU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |