C14H26O — CID 156623896
(3S,3aS)-6-butyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran (PubChem CID 156623896) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (3S,3aS)-6-butyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran.
| Compound Name | (3S,3aS)-6-butyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 156623896 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (3S,3aS)-6-butyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
| SMILES | CCCCC1(C)CC[C@@H]2C(C1)OC[C@H]2C |
| InChI | InChI=1S/C14H26O/c1-4-5-7-14(3)8-6-12-11(2)10-15-13(12)9-14/h11-13H,4-10H2,1-3H3/t11-,12+,13?,14?/m1/s1 |
| InChIKey | BGUAWGQGRRBQEO-KBHBFKLGSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |