C21H20LiN4O5- — CID 156624331
lithium;[5-[(2,4-dimethoxyphenyl)methylamino]-7-methoxyimidazo[1,2-c]quinazolin-2-yl]methanone;hydroxide (PubChem CID 156624331) has the molecular formula C21H20LiN4O5- and a molecular weight of 415.36 g/mol. Its IUPAC name is lithium;[5-[(2,4-dimethoxyphenyl)methylamino]-7-methoxyimidazo[1,2-c]quinazolin-2-yl]methanone;hydroxide.
| Compound Name | lithium;[5-[(2,4-dimethoxyphenyl)methylamino]-7-methoxyimidazo[1,2-c]quinazolin-2-yl]methanone;hydroxide |
|---|---|
| PubChem CID | 156624331 |
| Molecular Formula | C21H20LiN4O5- |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | lithium;[5-[(2,4-dimethoxyphenyl)methylamino]-7-methoxyimidazo[1,2-c]quinazolin-2-yl]methanone;hydroxide |
| SMILES | COc1ccc(CNc2nc3c(OC)cccc3c3nc([C-]=O)cn23)c(OC)c1.[Li+].[OH-] |
| InChI | InChI=1S/C21H19N4O4.Li.H2O/c1-27-15-8-7-13(18(9-15)29-3)10-22-21-24-19-16(5-4-6-17(19)28-2)20-23-14(12-26)11-25(20)21;;/h4-9,11H,10H2,1-3H3,(H,22,24);;1H2/q-1;+1;/p-1 |
| InChIKey | ZWRDLJZZKNGQNF-UHFFFAOYSA-M |
| XLogP | -0.19 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|