C22H42F6N2O4S2 — CID 156625546
bis(trifluoromethylsulfonyl)azanide;3-methyl-1-tetradecylpiperidin-1-ium (PubChem CID 156625546) has the molecular formula C22H42F6N2O4S2 and a molecular weight of 576.71 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;3-methyl-1-tetradecylpiperidin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;3-methyl-1-tetradecylpiperidin-1-ium |
|---|---|
| PubChem CID | 156625546 |
| Molecular Formula | C22H42F6N2O4S2 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;3-methyl-1-tetradecylpiperidin-1-ium |
| SMILES | CCCCCCCCCCCCCC[NH+]1CCCC(C)C1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H41N.C2F6NO4S2/c1-3-4-5-6-7-8-9-10-11-12-13-14-17-21-18-15-16-20(2)19-21;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h20H,3-19H2,1-2H3;/q;-1/p+1 |
| InChIKey | HXAMCFOFDJOVDD-UHFFFAOYSA-O |
| XLogP | 6.06 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|