C31H21BN2O3Pt — CID 156625687
9-[3-[3-(1,3,2-benzodioxaborol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-3,6-dimethylpyrido[2,3-b]indole;platinum(2+) (PubChem CID 156625687) has the molecular formula C31H21BN2O3Pt and a molecular weight of 675.41 g/mol. Its IUPAC name is 9-[3-[3-(1,3,2-benzodioxaborol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-3,6-dimethylpyrido[2,3-b]indole;platinum(2+).
| Compound Name | 9-[3-[3-(1,3,2-benzodioxaborol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-3,6-dimethylpyrido[2,3-b]indole;platinum(2+) |
|---|---|
| PubChem CID | 156625687 |
| Molecular Formula | C31H21BN2O3Pt |
| Molecular Weight | 675.41 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | 9-[3-[3-(1,3,2-benzodioxaborol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]-3,6-dimethylpyrido[2,3-b]indole;platinum(2+) |
| SMILES | Cc1ccc2c(c1)c1cc(C)cnc1n2-c1[c-]c(Oc2[c-]c(B3Oc4ccccc4O3)ccc2)ccc1.[Pt+2] |
| InChI | InChI=1S/C31H21BN2O3.Pt/c1-20-13-14-28-26(15-20)27-16-21(2)19-33-31(27)34(28)23-8-6-10-25(18-23)35-24-9-5-7-22(17-24)32-36-29-11-3-4-12-30(29)37-32;/h3-16,19H,1-2H3;/q-2;+2 |
| InChIKey | GFEQFVODVNQMAJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|