C50H27N7 — CID 156625981
4-(N-[5-(4-cyano-N-(4-cyanophenyl)anilino)-8-azahexacyclo[13.7.1.02,7.08,23.09,14.016,21]tricosa-1(23),2(7),3,5,9,11,13,15,17,19,21-undecaen-18-yl]-4-isocyanoanilino)benzonitrile (PubChem CID 156625981) has the molecular formula C50H27N7 and a molecular weight of 725.82 g/mol. Its IUPAC name is 4-(N-[5-(4-cyano-N-(4-cyanophenyl)anilino)-8-azahexacyclo[13.7.1.02,7.08,23.09,14.016,21]tricosa-1(23),2(7),3,5,9,11,13,15,17,19,21-undecaen-18-yl]-4-isocyanoanilino)benzonitrile.
| Compound Name | 4-(N-[5-(4-cyano-N-(4-cyanophenyl)anilino)-8-azahexacyclo[13.7.1.02,7.08,23.09,14.016,21]tricosa-1(23),2(7),3,5,9,11,13,15,17,19,21-undecaen-18-yl]-4-isocyanoanilino)benzonitrile |
|---|---|
| PubChem CID | 156625981 |
| Molecular Formula | C50H27N7 |
| Molecular Weight | 725.82 g/mol |
| Exact Mass | 725.23 |
| IUPAC Name | 4-(N-[5-(4-cyano-N-(4-cyanophenyl)anilino)-8-azahexacyclo[13.7.1.02,7.08,23.09,14.016,21]tricosa-1(23),2(7),3,5,9,11,13,15,17,19,21-undecaen-18-yl]-4-isocyanoanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(C#N)cc2)c2ccc3cc4c5ccc(N(c6ccc(C#N)cc6)c6ccc(C#N)cc6)cc5n5c6ccccc6c(c3c2)c45)cc1 |
| InChI | InChI=1S/C50H27N7/c1-54-36-13-22-40(23-14-36)55(37-15-6-32(29-51)7-16-37)41-21-12-35-26-46-43-25-24-42(28-48(43)57-47-5-3-2-4-44(47)49(50(46)57)45(35)27-41)56(38-17-8-33(30-52)9-18-38)39-19-10-34(31-53)11-20-39/h2-28H |
| InChIKey | OKBWPCQQPXQQKU-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 86.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.82 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|