C52H52N6Zn — CID 156629527
zinc bis((Z)-4-tert-butyl-N-[4-(2,6-dimethylphenyl)isoquinolin-3-yl]pyridin-1-id-2-imine) (PubChem CID 156629527) has the molecular formula C52H52N6Zn and a molecular weight of 826.42 g/mol. Its IUPAC name is zinc bis((Z)-4-tert-butyl-N-[4-(2,6-dimethylphenyl)isoquinolin-3-yl]pyridin-1-id-2-imine).
| Compound Name | zinc bis((Z)-4-tert-butyl-N-[4-(2,6-dimethylphenyl)isoquinolin-3-yl]pyridin-1-id-2-imine) |
|---|---|
| PubChem CID | 156629527 |
| Molecular Formula | C52H52N6Zn |
| Molecular Weight | 826.42 g/mol |
| Exact Mass | 824.35 |
| IUPAC Name | zinc bis((Z)-4-tert-butyl-N-[4-(2,6-dimethylphenyl)isoquinolin-3-yl]pyridin-1-id-2-imine) |
| SMILES | Cc1cccc(C)c1-c1c(/N=c2/cc(C(C)(C)C)cc[n-]2)ncc2ccccc12.Cc1cccc(C)c1-c1c(/N=c2/cc(C(C)(C)C)cc[n-]2)ncc2ccccc12.[Zn+2] |
| InChI | InChI=1S/2C26H26N3.Zn/c2*1-17-9-8-10-18(2)23(17)24-21-12-7-6-11-19(21)16-28-25(24)29-22-15-20(13-14-27-22)26(3,4)5;/h2*6-16H,1-5H3;/q2*-1;+2 |
| InChIKey | NBOSCAYVJGGMLX-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 78.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.42 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|