C35H37N3 — CID 147361697
2-tert-butyl-N-[5-tert-butyl-2-(methylideneamino)-3-(2-methylphenyl)phenyl]phenanthridin-4-amine (PubChem CID 147361697) has the molecular formula C35H37N3 and a molecular weight of 499.70 g/mol. Its IUPAC name is 2-tert-butyl-N-[5-tert-butyl-2-(methylideneamino)-3-(2-methylphenyl)phenyl]phenanthridin-4-amine.
| Compound Name | 2-tert-butyl-N-[5-tert-butyl-2-(methylideneamino)-3-(2-methylphenyl)phenyl]phenanthridin-4-amine |
|---|---|
| PubChem CID | 147361697 |
| Molecular Formula | C35H37N3 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 2-tert-butyl-N-[5-tert-butyl-2-(methylideneamino)-3-(2-methylphenyl)phenyl]phenanthridin-4-amine |
| SMILES | C=Nc1c(Nc2cc(C(C)(C)C)cc3c2ncc2ccccc23)cc(C(C)(C)C)cc1-c1ccccc1C |
| InChI | InChI=1S/C35H37N3/c1-22-13-9-11-15-26(22)28-17-24(34(2,3)4)19-30(32(28)36-8)38-31-20-25(35(5,6)7)18-29-27-16-12-10-14-23(27)21-37-33(29)31/h9-21,38H,8H2,1-7H3 |
| InChIKey | NBARHMUHNILVRQ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|