C52H39BN2O2Pt — CID 156629831
CID 156629831 (PubChem CID 156629831) has the molecular formula C52H39BN2O2Pt and a molecular weight of 929.79 g/mol.
| Compound Name | CID 156629831 |
|---|---|
| PubChem CID | 156629831 |
| Molecular Formula | C52H39BN2O2Pt |
| Molecular Weight | 929.79 g/mol |
| Exact Mass | 929.28 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c2c3c1Oc1ccc(-c4cc(-c5ccccc5)ccn4)[c-]c1B3c1[c-]c(-c3cc(-c4ccccc4-c4ccccc4)ccn3)ccc1O2.[Pt+2] |
| InChI | InChI=1S/C52H39BN2O2.Pt/c1-32(2)42-31-43(33(3)4)52-50-51(42)56-48-21-19-38(46-29-36(23-25-54-46)34-13-7-5-8-14-34)27-44(48)53(50)45-28-39(20-22-49(45)57-52)47-30-37(24-26-55-47)41-18-12-11-17-40(41)35-15-9-6-10-16-35;/h5-26,29-33H,1-4H3;/q-2;+2 |
| InChIKey | CGHABDLSXJIPAY-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.79 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|