C46H39BiN2Pt — CID 164733482
(2,6-diphenylphenyl)-bis[3-(4-propan-2-yl-2-pyridinyl)benzene-2-id-1-yl]bismuthane;platinum(2+) (PubChem CID 164733482) has the molecular formula C46H39BiN2Pt and a molecular weight of 1023.89 g/mol. Its IUPAC name is (2,6-diphenylphenyl)-bis[3-(4-propan-2-yl-2-pyridinyl)benzene-2-id-1-yl]bismuthane;platinum(2+).
| Compound Name | (2,6-diphenylphenyl)-bis[3-(4-propan-2-yl-2-pyridinyl)benzene-2-id-1-yl]bismuthane;platinum(2+) |
|---|---|
| PubChem CID | 164733482 |
| Molecular Formula | C46H39BiN2Pt |
| Molecular Weight | 1023.89 g/mol |
| Exact Mass | 1023.26 |
| IUPAC Name | (2,6-diphenylphenyl)-bis[3-(4-propan-2-yl-2-pyridinyl)benzene-2-id-1-yl]bismuthane;platinum(2+) |
| SMILES | CC(C)c1ccnc(-c2[c-]c([Bi](c3[c-]c(-c4cc(C(C)C)ccn4)ccc3)c3c(-c4ccccc4)cccc3-c3ccccc3)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C18H13.2C14H13N.Bi.Pt/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16;2*1-11(2)13-8-9-15-14(10-13)12-6-4-3-5-7-12;;/h1-13H;2*3-4,6,8-11H,1-2H3;;/q;2*-1;;+2 |
| InChIKey | IWENMYDFLWVGJD-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.89 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|