C42H45NO5 — CID 15663029
[(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]methanol (PubChem CID 15663029) has the molecular formula C42H45NO5 and a molecular weight of 643.82 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]methanol.
| Compound Name | [(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 15663029 |
| Molecular Formula | C42H45NO5 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-1-benzyl-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-yl]methanol |
| SMILES | OC[C@@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C42H45NO5/c44-27-38-40(46-29-35-20-10-3-11-21-35)42(48-31-37-24-14-5-15-25-37)41(47-30-36-22-12-4-13-23-36)39(32-45-28-34-18-8-2-9-19-34)43(38)26-33-16-6-1-7-17-33/h1-25,38-42,44H,26-32H2/t38-,39-,40+,41-,42-/m1/s1 |
| InChIKey | VJWNQPQYMIAZJI-QBLDGPCBSA-N |
| XLogP | 7.20 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |