C21H24N6O2 — CID 156630311
6-[[4-(7-aminoquinoxalin-5-yl)oxycyclohexyl]amino]-N-methylpyridine-3-carboxamide (PubChem CID 156630311) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 6-[[4-(7-aminoquinoxalin-5-yl)oxycyclohexyl]amino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[[4-(7-aminoquinoxalin-5-yl)oxycyclohexyl]amino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 156630311 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 6-[[4-(7-aminoquinoxalin-5-yl)oxycyclohexyl]amino]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(NC2CCC(Oc3cc(N)cc4nccnc34)CC2)nc1 |
| InChI | InChI=1S/C21H24N6O2/c1-23-21(28)13-2-7-19(26-12-13)27-15-3-5-16(6-4-15)29-18-11-14(22)10-17-20(18)25-9-8-24-17/h2,7-12,15-16H,3-6,22H2,1H3,(H,23,28)(H,26,27) |
| InChIKey | SJAVZLNFKLWJIX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|