C16H19ClN4O3S — CID 156635918
tert-butyl N-[5-amino-3-[(4-chlorophenyl)methyl]-6-oxo-2-sulfanylidenepyrimidin-4-yl]carbamate (PubChem CID 156635918) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is tert-butyl N-[5-amino-3-[(4-chlorophenyl)methyl]-6-oxo-2-sulfanylidenepyrimidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-3-[(4-chlorophenyl)methyl]-6-oxo-2-sulfanylidenepyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 156635918 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | tert-butyl N-[5-amino-3-[(4-chlorophenyl)methyl]-6-oxo-2-sulfanylidenepyrimidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(N)c(=O)[nH]c(=S)n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H19ClN4O3S/c1-16(2,3)24-15(23)19-12-11(18)13(22)20-14(25)21(12)8-9-4-6-10(17)7-5-9/h4-7H,8,18H2,1-3H3,(H,19,23)(H,20,22,25) |
| InChIKey | QZESUFXPBOJRMB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|