C10H13FN2O2S — CID 172716327
tert-butyl N-(5-fluoro-6-sulfanylidene-1H-pyridin-2-yl)carbamate (PubChem CID 172716327) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl N-(5-fluoro-6-sulfanylidene-1H-pyridin-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-fluoro-6-sulfanylidene-1H-pyridin-2-yl)carbamate |
|---|---|
| PubChem CID | 172716327 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | tert-butyl N-(5-fluoro-6-sulfanylidene-1H-pyridin-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)c(=S)[nH]1 |
| InChI | InChI=1S/C10H13FN2O2S/c1-10(2,3)15-9(14)13-7-5-4-6(11)8(16)12-7/h4-5H,1-3H3,(H2,12,13,14,16) |
| InChIKey | FXHFJIYCGYVKSY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|