C16H11BrF3N3OS — CID 156641571
2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-6-(trifluoromethyl)phthalazin-1-one (PubChem CID 156641571) has the molecular formula C16H11BrF3N3OS and a molecular weight of 430.25 g/mol. Its IUPAC name is 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-6-(trifluoromethyl)phthalazin-1-one.
| Compound Name | 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-6-(trifluoromethyl)phthalazin-1-one |
|---|---|
| PubChem CID | 156641571 |
| Molecular Formula | C16H11BrF3N3OS |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 2-(5-bromo-3-ethylsulfanyl-2-pyridinyl)-6-(trifluoromethyl)phthalazin-1-one |
| SMILES | CCSc1cc(Br)cnc1-n1ncc2cc(C(F)(F)F)ccc2c1=O |
| InChI | InChI=1S/C16H11BrF3N3OS/c1-2-25-13-6-11(17)8-21-14(13)23-15(24)12-4-3-10(16(18,19)20)5-9(12)7-22-23/h3-8H,2H2,1H3 |
| InChIKey | XQTDVIPSSLKNSQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |