C24H20N6O6 — CID 156642210
ethane;4-(3-ethynylphenoxy)-1H-triazole-5-carboxylic acid;4-(4-ethynylphenoxy)-1H-triazole-5-carboxylic acid (PubChem CID 156642210) has the molecular formula C24H20N6O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is ethane;4-(3-ethynylphenoxy)-1H-triazole-5-carboxylic acid;4-(4-ethynylphenoxy)-1H-triazole-5-carboxylic acid.
| Compound Name | ethane;4-(3-ethynylphenoxy)-1H-triazole-5-carboxylic acid;4-(4-ethynylphenoxy)-1H-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 156642210 |
| Molecular Formula | C24H20N6O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | ethane;4-(3-ethynylphenoxy)-1H-triazole-5-carboxylic acid;4-(4-ethynylphenoxy)-1H-triazole-5-carboxylic acid |
| SMILES | C#Cc1ccc(Oc2nn[nH]c2C(=O)O)cc1.C#Cc1cccc(Oc2nn[nH]c2C(=O)O)c1.CC |
| InChI | InChI=1S/2C11H7N3O3.C2H6/c1-2-7-3-5-8(6-4-7)17-10-9(11(15)16)12-14-13-10;1-2-7-4-3-5-8(6-7)17-10-9(11(15)16)12-14-13-10;1-2/h2*1,3-6H,(H,15,16)(H,12,13,14);1-2H3 |
| InChIKey | JEYQKHRGZPVDJQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 176.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|