C25H24N2 — CID 156643246
2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]-5,10-dihydro-4H-pyrrolo[2,3-a]carbazole;molecular hydrogen (PubChem CID 156643246) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]-5,10-dihydro-4H-pyrrolo[2,3-a]carbazole;molecular hydrogen.
| Compound Name | 2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]-5,10-dihydro-4H-pyrrolo[2,3-a]carbazole;molecular hydrogen |
|---|---|
| PubChem CID | 156643246 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-ethenyl-1-phenyl-3-[(Z)-prop-1-enyl]-5,10-dihydro-4H-pyrrolo[2,3-a]carbazole;molecular hydrogen |
| SMILES | C=Cc1c(/C=C\C)c2c(n1-c1ccccc1)-c1[nH]c3ccccc3c1CC2.[H][H] |
| InChI | InChI=1S/C25H22N2.H2/c1-3-10-19-21-16-15-20-18-13-8-9-14-22(18)26-24(20)25(21)27(23(19)4-2)17-11-6-5-7-12-17;/h3-14,26H,2,15-16H2,1H3;1H/b10-3-; |
| InChIKey | OSYSWGICUXVOHD-HVHUWTQGSA-N |
| XLogP | 6.65 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|