C18H29NO3 — CID 156645380
tert-butyl 4-(4-hydroxypiperidin-1-yl)benzoate;ethane (PubChem CID 156645380) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is tert-butyl 4-(4-hydroxypiperidin-1-yl)benzoate;ethane.
| Compound Name | tert-butyl 4-(4-hydroxypiperidin-1-yl)benzoate;ethane |
|---|---|
| PubChem CID | 156645380 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | tert-butyl 4-(4-hydroxypiperidin-1-yl)benzoate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)c1ccc(N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C16H23NO3.C2H6/c1-16(2,3)20-15(19)12-4-6-13(7-5-12)17-10-8-14(18)9-11-17;1-2/h4-7,14,18H,8-11H2,1-3H3;1-2H3 |
| InChIKey | MCRTYCCVONIPRB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |