C25H28F2N4O2 — CID 156646549
N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-(3,5-difluorophenyl)acetamide;N-methylpropan-2-amine (PubChem CID 156646549) has the molecular formula C25H28F2N4O2 and a molecular weight of 454.52 g/mol. Its IUPAC name is N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-(3,5-difluorophenyl)acetamide;N-methylpropan-2-amine.
| Compound Name | N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-(3,5-difluorophenyl)acetamide;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 156646549 |
| Molecular Formula | C25H28F2N4O2 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-(3,5-difluorophenyl)acetamide;N-methylpropan-2-amine |
| SMILES | CNC(C)C.Cc1cc(NC(=O)Cc2cc(F)cc(F)c2)ccc1-c1cnc(N)c(C=O)c1 |
| InChI | InChI=1S/C21H17F2N3O2.C4H11N/c1-12-4-18(26-20(28)7-13-5-16(22)9-17(23)6-13)2-3-19(12)14-8-15(11-27)21(24)25-10-14;1-4(2)5-3/h2-6,8-11H,7H2,1H3,(H2,24,25)(H,26,28);4-5H,1-3H3 |
| InChIKey | HBSLEWDUQVEOJK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|