C29H36N4O — CID 123928261
3-[4-(6-amino-5-methanimidoyl-3-pyridinyl)phenyl]-N-(4-hexyl-3-methylphenyl)butanamide (PubChem CID 123928261) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 3-[4-(6-amino-5-methanimidoyl-3-pyridinyl)phenyl]-N-(4-hexyl-3-methylphenyl)butanamide.
| Compound Name | 3-[4-(6-amino-5-methanimidoyl-3-pyridinyl)phenyl]-N-(4-hexyl-3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 123928261 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 3-[4-(6-amino-5-methanimidoyl-3-pyridinyl)phenyl]-N-(4-hexyl-3-methylphenyl)butanamide |
| SMILES | [H]/N=C/c1cc(-c2ccc(C(C)CC(=O)Nc3ccc(CCCCCC)c(C)c3)cc2)cnc1N |
| InChI | InChI=1S/C29H36N4O/c1-4-5-6-7-8-22-13-14-27(15-20(22)2)33-28(34)16-21(3)23-9-11-24(12-10-23)26-17-25(18-30)29(31)32-19-26/h9-15,17-19,21,30H,4-8,16H2,1-3H3,(H2,31,32)(H,33,34)/b30-18+ |
| InChIKey | KORHNMFUOGPLMB-UXHLAJHPSA-N |
| XLogP | 6.89 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|