C24H34N4O2 — CID 156646639
N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-cyclopentylacetamide;N-methylpropan-2-amine (PubChem CID 156646639) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-cyclopentylacetamide;N-methylpropan-2-amine.
| Compound Name | N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-cyclopentylacetamide;N-methylpropan-2-amine |
|---|---|
| PubChem CID | 156646639 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | N-[4-(6-amino-5-formyl-3-pyridinyl)-3-methylphenyl]-2-cyclopentylacetamide;N-methylpropan-2-amine |
| SMILES | CNC(C)C.Cc1cc(NC(=O)CC2CCCC2)ccc1-c1cnc(N)c(C=O)c1 |
| InChI | InChI=1S/C20H23N3O2.C4H11N/c1-13-8-17(23-19(25)9-14-4-2-3-5-14)6-7-18(13)15-10-16(12-24)20(21)22-11-15;1-4(2)5-3/h6-8,10-12,14H,2-5,9H2,1H3,(H2,21,22)(H,23,25);4-5H,1-3H3 |
| InChIKey | PAXWSZSYXASSBL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|