C18H20N2O — CID 169175816
2-cyclobutyl-N-(4-methyl-3-pyridin-2-ylphenyl)acetamide (PubChem CID 169175816) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-cyclobutyl-N-(4-methyl-3-pyridin-2-ylphenyl)acetamide.
| Compound Name | 2-cyclobutyl-N-(4-methyl-3-pyridin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 169175816 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-cyclobutyl-N-(4-methyl-3-pyridin-2-ylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2CCC2)cc1-c1ccccn1 |
| InChI | InChI=1S/C18H20N2O/c1-13-8-9-15(20-18(21)11-14-5-4-6-14)12-16(13)17-7-2-3-10-19-17/h2-3,7-10,12,14H,4-6,11H2,1H3,(H,20,21) |
| InChIKey | BGINSCFNYNBHKU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |