C20H22N2O — CID 176763932
(1S)-N-(4-methyl-3-pyridin-2-ylphenyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 176763932) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (1S)-N-(4-methyl-3-pyridin-2-ylphenyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S)-N-(4-methyl-3-pyridin-2-ylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 176763932 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S)-N-(4-methyl-3-pyridin-2-ylphenyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3CC[C@H]2C3)cc1-c1ccccn1 |
| InChI | InChI=1S/C20H22N2O/c1-13-5-8-16(12-17(13)19-4-2-3-9-21-19)22-20(23)18-11-14-6-7-15(18)10-14/h2-5,8-9,12,14-15,18H,6-7,10-11H2,1H3,(H,22,23)/t14?,15-,18?/m0/s1 |
| InChIKey | LZGUFQJNRLXJPI-CSLYMUCUSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |