C20H24ClNO3 — CID 15664782
(4R)-4-(4-chlorobutyl)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxynaphthalen-1-one (PubChem CID 15664782) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (4R)-4-(4-chlorobutyl)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxynaphthalen-1-one.
| Compound Name | (4R)-4-(4-chlorobutyl)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxynaphthalen-1-one |
|---|---|
| PubChem CID | 15664782 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (4R)-4-(4-chlorobutyl)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxynaphthalen-1-one |
| SMILES | COC1=CC(=O)c2ccccc2[C@@]1(CCCCCl)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C20H24ClNO3/c1-19(2)13-25-18(22-19)20(10-6-7-11-21)15-9-5-4-8-14(15)16(23)12-17(20)24-3/h4-5,8-9,12H,6-7,10-11,13H2,1-3H3/t20-/m1/s1 |
| InChIKey | XSHBUCQUYHEJQG-HXUWFJFHSA-N |
| XLogP | 4.27 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|