C22H27NO3 — CID 15664783
(4R)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxy-4-(4-methylpent-3-enyl)naphthalen-1-one (PubChem CID 15664783) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (4R)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxy-4-(4-methylpent-3-enyl)naphthalen-1-one.
| Compound Name | (4R)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxy-4-(4-methylpent-3-enyl)naphthalen-1-one |
|---|---|
| PubChem CID | 15664783 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (4R)-4-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-methoxy-4-(4-methylpent-3-enyl)naphthalen-1-one |
| SMILES | COC1=CC(=O)c2ccccc2[C@@]1(CCC=C(C)C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C22H27NO3/c1-15(2)9-8-12-22(20-23-21(3,4)14-26-20)17-11-7-6-10-16(17)18(24)13-19(22)25-5/h6-7,9-11,13H,8,12,14H2,1-5H3/t22-/m1/s1 |
| InChIKey | CMYGYVHGWGMFGP-JOCHJYFZSA-N |
| XLogP | 4.60 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|