C21H37N3O — CID 156648450
1-(cyclopropylmethyl)-3-hydroxyazetidine-3-carbonitrile;ethane;1-(2-methylhex-3-yn-2-yl)pyrrolidine (PubChem CID 156648450) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-hydroxyazetidine-3-carbonitrile;ethane;1-(2-methylhex-3-yn-2-yl)pyrrolidine.
| Compound Name | 1-(cyclopropylmethyl)-3-hydroxyazetidine-3-carbonitrile;ethane;1-(2-methylhex-3-yn-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 156648450 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-hydroxyazetidine-3-carbonitrile;ethane;1-(2-methylhex-3-yn-2-yl)pyrrolidine |
| SMILES | CC.CCC#CC(C)(C)N1CCCC1.N#CC1(O)CN(CC2CC2)C1 |
| InChI | InChI=1S/C11H19N.C8H12N2O.C2H6/c1-4-5-8-11(2,3)12-9-6-7-10-12;9-4-8(11)5-10(6-8)3-7-1-2-7;1-2/h4,6-7,9-10H2,1-3H3;7,11H,1-3,5-6H2;1-2H3 |
| InChIKey | WCHLRKNMHXPQSC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|