C24H25B3O2 — CID 156648763
CID 156648763 (PubChem CID 156648763) has the molecular formula C24H25B3O2 and a molecular weight of 377.90 g/mol.
| Compound Name | CID 156648763 |
|---|---|
| PubChem CID | 156648763 |
| Molecular Formula | C24H25B3O2 |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])C1=CC2c3c(O)cc(CCc4ccccc4)cc3OC(C)(C)C2CC1 |
| InChI | InChI=1S/C24H25B3O2/c1-23(2)19-11-10-17(24(25,26)27)14-18(19)22-20(28)12-16(13-21(22)29-23)9-8-15-6-4-3-5-7-15/h3-7,12-14,18-19,28H,8-11H2,1-2H3 |
| InChIKey | WGHNHAAUOTYISG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|