C11H12BNO5 — CID 156654423
(6,7-dimethoxyquinolin-3-yl)oxyboronic acid (PubChem CID 156654423) has the molecular formula C11H12BNO5 and a molecular weight of 249.03 g/mol. Its IUPAC name is (6,7-dimethoxyquinolin-3-yl)oxyboronic acid.
| Compound Name | (6,7-dimethoxyquinolin-3-yl)oxyboronic acid |
|---|---|
| PubChem CID | 156654423 |
| Molecular Formula | C11H12BNO5 |
| Molecular Weight | 249.03 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (6,7-dimethoxyquinolin-3-yl)oxyboronic acid |
| SMILES | COc1cc2cc(OB(O)O)cnc2cc1OC |
| InChI | InChI=1S/C11H12BNO5/c1-16-10-4-7-3-8(18-12(14)15)6-13-9(7)5-11(10)17-2/h3-6,14-15H,1-2H3 |
| InChIKey | ZCFRBWMCYOFRJH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.03 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|